slm002.JPG

Descriptors

Caffeine
1,3,7-trimethyl-3,7-dihydro-1H-purine-2,6-dione
SMILES: O=C2N(c1ncn(c1C(=O)N2C)C)C
InChI=1/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3

SLURL

http://slurl.com/secondlife/Second%20Nature/138/115/24