5mfa.JPG

Descriptors

SMILES: NCc1oc(cc1)C
(5-methyl-2-furyl)methylamine or 5-methylfurfurylamine
InChI=1/C6H9NO/c1-5-2-3-6(4-7)8-5/h2-3H,4,7H2,1H3
Molecular Formula: C6H9NO

SLURLS

http://slurl.com/secondlife/Drexel/226/194/25